C27H28N4O2 — CID 44515157
2-[[3-cyano-4-(4-propan-2-ylphenyl)-6-(5,6,7,8-tetrahydronaphthalen-2-yl)-2-pyridinyl]oxy]acetohydrazide (PubChem CID 44515157) has the molecular formula C27H28N4O2 and a molecular weight of 440.55 g/mol. Its IUPAC name is 2-[[3-cyano-4-(4-propan-2-ylphenyl)-6-(5,6,7,8-tetrahydronaphthalen-2-yl)-2-pyridinyl]oxy]acetohydrazide.
| Compound Name | 2-[[3-cyano-4-(4-propan-2-ylphenyl)-6-(5,6,7,8-tetrahydronaphthalen-2-yl)-2-pyridinyl]oxy]acetohydrazide |
|---|---|
| PubChem CID | 44515157 |
| Molecular Formula | C27H28N4O2 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | 2-[[3-cyano-4-(4-propan-2-ylphenyl)-6-(5,6,7,8-tetrahydronaphthalen-2-yl)-2-pyridinyl]oxy]acetohydrazide |
| SMILES | CC(C)c1ccc(-c2cc(-c3ccc4c(c3)CCCC4)nc(OCC(=O)NN)c2C#N)cc1 |
| InChI | InChI=1S/C27H28N4O2/c1-17(2)18-7-10-20(11-8-18)23-14-25(22-12-9-19-5-3-4-6-21(19)13-22)30-27(24(23)15-28)33-16-26(32)31-29/h7-14,17H,3-6,16,29H2,1-2H3,(H,31,32) |
| InChIKey | UAFLVLOHXHZQHA-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 101.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|