About propan-2-yl 12-methyltridecanoate
propan-2-yl 12-methyltridecanoate (PubChem CID 44515574) has the molecular formula C17H34O2
and a molecular weight of 270.46 g/mol. Its IUPAC name is propan-2-yl 12-methyltridecanoate.
Molecular Properties
| Compound Name | propan-2-yl 12-methyltridecanoate |
| PubChem CID | 44515574 |
| Molecular Formula | C17H34O2 |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.26 |
| IUPAC Name | propan-2-yl 12-methyltridecanoate |
| SMILES | CC(C)CCCCCCCCCCC(=O)OC(C)C |
| InChI | InChI=1S/C17H34O2/c1-15(2)13-11-9-7-5-6-8-10-12-14-17(18)19-16(3)4/h15-16H,5-14H2,1-4H3 |
| InChIKey | OGLLIZLJSTXFCW-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl 12-methyltridecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 12-methyltridecanoate?
The IUPAC name of propan-2-yl 12-methyltridecanoate (CID 44515574) is propan-2-yl 12-methyltridecanoate.
What is the SMILES notation for propan-2-yl 12-methyltridecanoate?
The canonical SMILES for propan-2-yl 12-methyltridecanoate is CC(C)CCCCCCCCCCC(=O)OC(C)C.
What is the InChIKey of propan-2-yl 12-methyltridecanoate?
The InChIKey is OGLLIZLJSTXFCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H34O2/c1-15(2)13-11-9-7-5-6-8-10-12-14-17(18)19-16(3)4/h15-16H,5-14H2,1-4H3.
What are the key properties of propan-2-yl 12-methyltridecanoate?
propan-2-yl 12-methyltridecanoate has a molecular weight of 270.46 g/mol, XLogP of 5.49, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 12-methyltridecanoate is sourced from PubChem (CID 44515574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).