C19H23N5O — CID 44515686
6-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-N-(2-phenylethyl)pyrazine-2-carboxamide (PubChem CID 44515686) has the molecular formula C19H23N5O and a molecular weight of 337.43 g/mol. Its IUPAC name is 6-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-N-(2-phenylethyl)pyrazine-2-carboxamide.
| Compound Name | 6-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-N-(2-phenylethyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 44515686 |
| Molecular Formula | C19H23N5O |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | 6-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-N-(2-phenylethyl)pyrazine-2-carboxamide |
| SMILES | O=C(NCCc1ccccc1)c1cncc(N2C[C@H]3CNC[C@H]3C2)n1 |
| InChI | InChI=1S/C19H23N5O/c25-19(22-7-6-14-4-2-1-3-5-14)17-10-21-11-18(23-17)24-12-15-8-20-9-16(15)13-24/h1-5,10-11,15-16,20H,6-9,12-13H2,(H,22,25)/t15-,16+ |
| InChIKey | RNOQMFLTYWESRB-IYBDPMFKSA-N |
| XLogP | 1.10 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |