C33H40N4O3 — CID 44516121
2-[4-[4-(5-methoxy-1H-indol-3-yl)piperidin-1-yl]butyl]-4-(2-methylphenyl)-5,6,7,8-tetrahydropyrido[1,2-c]pyrimidine-1,3-dione (PubChem CID 44516121) has the molecular formula C33H40N4O3 and a molecular weight of 540.71 g/mol. Its IUPAC name is 2-[4-[4-(5-methoxy-1H-indol-3-yl)piperidin-1-yl]butyl]-4-(2-methylphenyl)-5,6,7,8-tetrahydropyrido[1,2-c]pyrimidine-1,3-dione.
| Compound Name | 2-[4-[4-(5-methoxy-1H-indol-3-yl)piperidin-1-yl]butyl]-4-(2-methylphenyl)-5,6,7,8-tetrahydropyrido[1,2-c]pyrimidine-1,3-dione |
|---|---|
| PubChem CID | 44516121 |
| Molecular Formula | C33H40N4O3 |
| Molecular Weight | 540.71 g/mol |
| Exact Mass | 540.31 |
| IUPAC Name | 2-[4-[4-(5-methoxy-1H-indol-3-yl)piperidin-1-yl]butyl]-4-(2-methylphenyl)-5,6,7,8-tetrahydropyrido[1,2-c]pyrimidine-1,3-dione |
| SMILES | COc1ccc2[nH]cc(C3CCN(CCCCn4c(=O)c(-c5ccccc5C)c5n(c4=O)CCCC5)CC3)c2c1 |
| InChI | InChI=1S/C33H40N4O3/c1-23-9-3-4-10-26(23)31-30-11-5-6-17-36(30)33(39)37(32(31)38)18-8-7-16-35-19-14-24(15-20-35)28-22-34-29-13-12-25(40-2)21-27(28)29/h3-4,9-10,12-13,21-22,24,34H,5-8,11,14-20H2,1-2H3 |
| InChIKey | BMKGKYCRFOOCOC-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 72.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.71 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|