C19H31NO6 — CID 44516204
ethyl (3aR,6R,7S,7aS)-7-acetamido-2,2-dimethyl-6-pentan-3-yloxy-3a,6,7,7a-tetrahydro-1,3-benzodioxole-4-carboxylate (PubChem CID 44516204) has the molecular formula C19H31NO6 and a molecular weight of 369.46 g/mol. Its IUPAC name is ethyl (3aR,6R,7S,7aS)-7-acetamido-2,2-dimethyl-6-pentan-3-yloxy-3a,6,7,7a-tetrahydro-1,3-benzodioxole-4-carboxylate.
| Compound Name | ethyl (3aR,6R,7S,7aS)-7-acetamido-2,2-dimethyl-6-pentan-3-yloxy-3a,6,7,7a-tetrahydro-1,3-benzodioxole-4-carboxylate |
|---|---|
| PubChem CID | 44516204 |
| Molecular Formula | C19H31NO6 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | ethyl (3aR,6R,7S,7aS)-7-acetamido-2,2-dimethyl-6-pentan-3-yloxy-3a,6,7,7a-tetrahydro-1,3-benzodioxole-4-carboxylate |
| SMILES | CCOC(=O)C1=C[C@@H](OC(CC)CC)[C@H](NC(C)=O)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C19H31NO6/c1-7-12(8-2)24-14-10-13(18(22)23-9-3)16-17(15(14)20-11(4)21)26-19(5,6)25-16/h10,12,14-17H,7-9H2,1-6H3,(H,20,21)/t14-,15+,16-,17+/m1/s1 |
| InChIKey | LYDYSASGASGLHR-TWMKSMIVSA-N |
| XLogP | 2.09 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |