C18H27NO7 — CID 44516207
ethyl (3aS,4S,7R,7aS)-7-acetamido-4-acetyloxy-2,2-diethyl-7,7a-dihydro-3aH-1,3-benzodioxole-4-carboxylate (PubChem CID 44516207) has the molecular formula C18H27NO7 and a molecular weight of 369.41 g/mol. Its IUPAC name is ethyl (3aS,4S,7R,7aS)-7-acetamido-4-acetyloxy-2,2-diethyl-7,7a-dihydro-3aH-1,3-benzodioxole-4-carboxylate.
| Compound Name | ethyl (3aS,4S,7R,7aS)-7-acetamido-4-acetyloxy-2,2-diethyl-7,7a-dihydro-3aH-1,3-benzodioxole-4-carboxylate |
|---|---|
| PubChem CID | 44516207 |
| Molecular Formula | C18H27NO7 |
| Molecular Weight | 369.41 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | ethyl (3aS,4S,7R,7aS)-7-acetamido-4-acetyloxy-2,2-diethyl-7,7a-dihydro-3aH-1,3-benzodioxole-4-carboxylate |
| SMILES | CCOC(=O)[C@]1(OC(C)=O)C=C[C@@H](NC(C)=O)[C@@H]2OC(CC)(CC)O[C@@H]21 |
| InChI | InChI=1S/C18H27NO7/c1-6-17(7-2)25-14-13(19-11(4)20)9-10-18(15(14)26-17,24-12(5)21)16(22)23-8-3/h9-10,13-15H,6-8H2,1-5H3,(H,19,20)/t13-,14+,15+,18+/m1/s1 |
| InChIKey | SSMXHFJSGQRMCB-LLDVTBCESA-N |
| XLogP | 1.23 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.41 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|