C17H20N4O — CID 44516297
(3aR,6aS)-5-(6-phenylmethoxypyrazin-2-yl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole (PubChem CID 44516297) has the molecular formula C17H20N4O and a molecular weight of 296.37 g/mol. Its IUPAC name is (3aR,6aS)-5-(6-phenylmethoxypyrazin-2-yl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole.
| Compound Name | (3aR,6aS)-5-(6-phenylmethoxypyrazin-2-yl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 44516297 |
| Molecular Formula | C17H20N4O |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | (3aR,6aS)-5-(6-phenylmethoxypyrazin-2-yl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
| SMILES | c1ccc(COc2cncc(N3C[C@H]4CNC[C@H]4C3)n2)cc1 |
| InChI | InChI=1S/C17H20N4O/c1-2-4-13(5-3-1)12-22-17-9-19-8-16(20-17)21-10-14-6-18-7-15(14)11-21/h1-5,8-9,14-15,18H,6-7,10-12H2/t14-,15+ |
| InChIKey | TUKGSZUVGBXOHF-GASCZTMLSA-N |
| XLogP | 1.71 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |