C16H27NO — CID 44516380
(E,5R,6S,9R)-N-methoxy-3,6-dimethyl-9-propan-2-ylspiro[4.5]dec-3-en-10-imine (PubChem CID 44516380) has the molecular formula C16H27NO and a molecular weight of 249.40 g/mol. Its IUPAC name is (E,5R,6S,9R)-N-methoxy-3,6-dimethyl-9-propan-2-ylspiro[4.5]dec-3-en-10-imine.
| Compound Name | (E,5R,6S,9R)-N-methoxy-3,6-dimethyl-9-propan-2-ylspiro[4.5]dec-3-en-10-imine |
|---|---|
| PubChem CID | 44516380 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | (E,5R,6S,9R)-N-methoxy-3,6-dimethyl-9-propan-2-ylspiro[4.5]dec-3-en-10-imine |
| SMILES | CO/N=C1\[C@@H](C(C)C)CC[C@H](C)[C@]12C=C(C)CC2 |
| InChI | InChI=1S/C16H27NO/c1-11(2)14-7-6-13(4)16(15(14)17-18-5)9-8-12(3)10-16/h10-11,13-14H,6-9H2,1-5H3/b17-15+/t13-,14+,16-/m0/s1 |
| InChIKey | PMXFPCNLJRRQID-WLHPEJTHSA-N |
| XLogP | 4.42 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|