C16H25NO6 — CID 44516523
ethyl (3aS,4S,7R,7aS)-7-acetamido-2,2-diethyl-4-hydroxy-7,7a-dihydro-3aH-1,3-benzodioxole-4-carboxylate (PubChem CID 44516523) has the molecular formula C16H25NO6 and a molecular weight of 327.38 g/mol. Its IUPAC name is ethyl (3aS,4S,7R,7aS)-7-acetamido-2,2-diethyl-4-hydroxy-7,7a-dihydro-3aH-1,3-benzodioxole-4-carboxylate.
| Compound Name | ethyl (3aS,4S,7R,7aS)-7-acetamido-2,2-diethyl-4-hydroxy-7,7a-dihydro-3aH-1,3-benzodioxole-4-carboxylate |
|---|---|
| PubChem CID | 44516523 |
| Molecular Formula | C16H25NO6 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | ethyl (3aS,4S,7R,7aS)-7-acetamido-2,2-diethyl-4-hydroxy-7,7a-dihydro-3aH-1,3-benzodioxole-4-carboxylate |
| SMILES | CCOC(=O)[C@]1(O)C=C[C@@H](NC(C)=O)[C@@H]2OC(CC)(CC)O[C@@H]21 |
| InChI | InChI=1S/C16H25NO6/c1-5-15(6-2)22-12-11(17-10(4)18)8-9-16(20,13(12)23-15)14(19)21-7-3/h8-9,11-13,20H,5-7H2,1-4H3,(H,17,18)/t11-,12+,13+,16+/m1/s1 |
| InChIKey | KXMNUTAAYHZCHH-DVZHBHJUSA-N |
| XLogP | 0.66 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|