About ethyl (2R)-2-acetamido-3-[5-(2,4-difluorophenyl)-2-hydroxybenzoyl]sulfanylpropanoate
ethyl (2R)-2-acetamido-3-[5-(2,4-difluorophenyl)-2-hydroxybenzoyl]sulfanylpropanoate (PubChem CID 44516576) has the molecular formula C20H19F2NO5S
and a molecular weight of 423.44 g/mol. Its IUPAC name is ethyl (2R)-2-acetamido-3-[5-(2,4-difluorophenyl)-2-hydroxybenzoyl]sulfanylpropanoate.
Molecular Properties
| Compound Name | ethyl (2R)-2-acetamido-3-[5-(2,4-difluorophenyl)-2-hydroxybenzoyl]sulfanylpropanoate |
| PubChem CID | 44516576 |
| Molecular Formula | C20H19F2NO5S |
| Molecular Weight | 423.44 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | ethyl (2R)-2-acetamido-3-[5-(2,4-difluorophenyl)-2-hydroxybenzoyl]sulfanylpropanoate |
| SMILES | CCOC(=O)[C@H](CSC(=O)c1cc(-c2ccc(F)cc2F)ccc1O)NC(C)=O |
| InChI | InChI=1S/C20H19F2NO5S/c1-3-28-19(26)17(23-11(2)24)10-29-20(27)15-8-12(4-7-18(15)25)14-6-5-13(21)9-16(14)22/h4-9,17,25H,3,10H2,1-2H3,(H,23,24)/t17-/m0/s1 |
| InChIKey | DAPCGHXDESAWDC-KRWDZBQOSA-N |
| XLogP | 3.28 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.44 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze ethyl (2R)-2-acetamido-3-[5-(2,4-difluorophenyl)-2-hydroxybenzoyl]sulfanylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2R)-2-acetamido-3-[5-(2,4-difluorophenyl)-2-hydroxybenzoyl]sulfanylpropanoate?
The IUPAC name of ethyl (2R)-2-acetamido-3-[5-(2,4-difluorophenyl)-2-hydroxybenzoyl]sulfanylpropanoate (CID 44516576) is ethyl (2R)-2-acetamido-3-[5-(2,4-difluorophenyl)-2-hydroxybenzoyl]sulfanylpropanoate.
What is the SMILES notation for ethyl (2R)-2-acetamido-3-[5-(2,4-difluorophenyl)-2-hydroxybenzoyl]sulfanylpropanoate?
The canonical SMILES for ethyl (2R)-2-acetamido-3-[5-(2,4-difluorophenyl)-2-hydroxybenzoyl]sulfanylpropanoate is CCOC(=O)[C@H](CSC(=O)c1cc(-c2ccc(F)cc2F)ccc1O)NC(C)=O.
What is the InChIKey of ethyl (2R)-2-acetamido-3-[5-(2,4-difluorophenyl)-2-hydroxybenzoyl]sulfanylpropanoate?
The InChIKey is DAPCGHXDESAWDC-KRWDZBQOSA-N. The full InChI is InChI=1S/C20H19F2NO5S/c1-3-28-19(26)17(23-11(2)24)10-29-20(27)15-8-12(4-7-18(15)25)14-6-5-13(21)9-16(14)22/h4-9,17,25H,3,10H2,1-2H3,(H,23,24)/t17-/m0/s1.
What are the key properties of ethyl (2R)-2-acetamido-3-[5-(2,4-difluorophenyl)-2-hydroxybenzoyl]sulfanylpropanoate?
ethyl (2R)-2-acetamido-3-[5-(2,4-difluorophenyl)-2-hydroxybenzoyl]sulfanylpropanoate has a molecular weight of 423.44 g/mol, XLogP of 3.28, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2R)-2-acetamido-3-[5-(2,4-difluorophenyl)-2-hydroxybenzoyl]sulfanylpropanoate is sourced from PubChem (CID 44516576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).