About methyl (2R)-2-acetamido-3-[5-(2,4-difluorophenyl)-2-hydroxybenzoyl]sulfanylpropanoate
methyl (2R)-2-acetamido-3-[5-(2,4-difluorophenyl)-2-hydroxybenzoyl]sulfanylpropanoate (PubChem CID 44516577) has the molecular formula C19H17F2NO5S
and a molecular weight of 409.41 g/mol. Its IUPAC name is methyl (2R)-2-acetamido-3-[5-(2,4-difluorophenyl)-2-hydroxybenzoyl]sulfanylpropanoate.
Molecular Properties
| Compound Name | methyl (2R)-2-acetamido-3-[5-(2,4-difluorophenyl)-2-hydroxybenzoyl]sulfanylpropanoate |
| PubChem CID | 44516577 |
| Molecular Formula | C19H17F2NO5S |
| Molecular Weight | 409.41 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | methyl (2R)-2-acetamido-3-[5-(2,4-difluorophenyl)-2-hydroxybenzoyl]sulfanylpropanoate |
| SMILES | COC(=O)[C@H](CSC(=O)c1cc(-c2ccc(F)cc2F)ccc1O)NC(C)=O |
| InChI | InChI=1S/C19H17F2NO5S/c1-10(23)22-16(18(25)27-2)9-28-19(26)14-7-11(3-6-17(14)24)13-5-4-12(20)8-15(13)21/h3-8,16,24H,9H2,1-2H3,(H,22,23)/t16-/m0/s1 |
| InChIKey | NNLLQWZAKQGVFV-INIZCTEOSA-N |
| XLogP | 2.89 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.41 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze methyl (2R)-2-acetamido-3-[5-(2,4-difluorophenyl)-2-hydroxybenzoyl]sulfanylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2R)-2-acetamido-3-[5-(2,4-difluorophenyl)-2-hydroxybenzoyl]sulfanylpropanoate?
The IUPAC name of methyl (2R)-2-acetamido-3-[5-(2,4-difluorophenyl)-2-hydroxybenzoyl]sulfanylpropanoate (CID 44516577) is methyl (2R)-2-acetamido-3-[5-(2,4-difluorophenyl)-2-hydroxybenzoyl]sulfanylpropanoate.
What is the SMILES notation for methyl (2R)-2-acetamido-3-[5-(2,4-difluorophenyl)-2-hydroxybenzoyl]sulfanylpropanoate?
The canonical SMILES for methyl (2R)-2-acetamido-3-[5-(2,4-difluorophenyl)-2-hydroxybenzoyl]sulfanylpropanoate is COC(=O)[C@H](CSC(=O)c1cc(-c2ccc(F)cc2F)ccc1O)NC(C)=O.
What is the InChIKey of methyl (2R)-2-acetamido-3-[5-(2,4-difluorophenyl)-2-hydroxybenzoyl]sulfanylpropanoate?
The InChIKey is NNLLQWZAKQGVFV-INIZCTEOSA-N. The full InChI is InChI=1S/C19H17F2NO5S/c1-10(23)22-16(18(25)27-2)9-28-19(26)14-7-11(3-6-17(14)24)13-5-4-12(20)8-15(13)21/h3-8,16,24H,9H2,1-2H3,(H,22,23)/t16-/m0/s1.
What are the key properties of methyl (2R)-2-acetamido-3-[5-(2,4-difluorophenyl)-2-hydroxybenzoyl]sulfanylpropanoate?
methyl (2R)-2-acetamido-3-[5-(2,4-difluorophenyl)-2-hydroxybenzoyl]sulfanylpropanoate has a molecular weight of 409.41 g/mol, XLogP of 2.89, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R)-2-acetamido-3-[5-(2,4-difluorophenyl)-2-hydroxybenzoyl]sulfanylpropanoate is sourced from PubChem (CID 44516577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).