C22H39NO4 — CID 44516700
tert-butyl (2S,5S)-2-butyl-5-[(Z)-3-(2-propyl-1,3-dioxolan-2-yl)prop-1-enyl]pyrrolidine-1-carboxylate (PubChem CID 44516700) has the molecular formula C22H39NO4 and a molecular weight of 381.56 g/mol. Its IUPAC name is tert-butyl (2S,5S)-2-butyl-5-[(Z)-3-(2-propyl-1,3-dioxolan-2-yl)prop-1-enyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,5S)-2-butyl-5-[(Z)-3-(2-propyl-1,3-dioxolan-2-yl)prop-1-enyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 44516700 |
| Molecular Formula | C22H39NO4 |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 381.29 |
| IUPAC Name | tert-butyl (2S,5S)-2-butyl-5-[(Z)-3-(2-propyl-1,3-dioxolan-2-yl)prop-1-enyl]pyrrolidine-1-carboxylate |
| SMILES | CCCC[C@H]1CC[C@@H](/C=C\CC2(CCC)OCCO2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H39NO4/c1-6-8-10-18-12-13-19(23(18)20(24)27-21(3,4)5)11-9-15-22(14-7-2)25-16-17-26-22/h9,11,18-19H,6-8,10,12-17H2,1-5H3/b11-9-/t18-,19+/m0/s1 |
| InChIKey | UIDVWUQUOHASRX-INOCBIGXSA-N |
| XLogP | 5.43 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|