C23H22ClF3O3S — CID 44516885
5-[3-[(1R,2R,3R,5R)-5-chloro-3-hydroxy-2-[3-[3-(trifluoromethyl)phenyl]propa-1,2-dienyl]cyclopentyl]propyl]thiophene-2-carboxylic acid (PubChem CID 44516885) has the molecular formula C23H22ClF3O3S and a molecular weight of 470.94 g/mol. Its IUPAC name is 5-[3-[(1R,2R,3R,5R)-5-chloro-3-hydroxy-2-[3-[3-(trifluoromethyl)phenyl]propa-1,2-dienyl]cyclopentyl]propyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[3-[(1R,2R,3R,5R)-5-chloro-3-hydroxy-2-[3-[3-(trifluoromethyl)phenyl]propa-1,2-dienyl]cyclopentyl]propyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 44516885 |
| Molecular Formula | C23H22ClF3O3S |
| Molecular Weight | 470.94 g/mol |
| Exact Mass | 470.09 |
| IUPAC Name | 5-[3-[(1R,2R,3R,5R)-5-chloro-3-hydroxy-2-[3-[3-(trifluoromethyl)phenyl]propa-1,2-dienyl]cyclopentyl]propyl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(CCC[C@@H]2[C@@H](C=C=Cc3cccc(C(F)(F)F)c3)[C@H](O)C[C@H]2Cl)s1 |
| InChI | InChI=1S/C23H22ClF3O3S/c24-19-13-20(28)18(9-2-5-14-4-1-6-15(12-14)23(25,26)27)17(19)8-3-7-16-10-11-21(31-16)22(29)30/h1,4-6,9-12,17-20,28H,3,7-8,13H2,(H,29,30)/t2?,17-,18-,19-,20-/m1/s1 |
| InChIKey | XSBZPTYEJNSKSD-BIDBHKLCSA-N |
| XLogP | 6.26 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.94 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|