C17H18N4O4S2 — CID 44517063
4-[1,2-bis(benzenesulfonyl)ethyl]-4H-pyrazole-3,5-diamine (PubChem CID 44517063) has the molecular formula C17H18N4O4S2 and a molecular weight of 406.49 g/mol. Its IUPAC name is 4-[1,2-bis(benzenesulfonyl)ethyl]-4H-pyrazole-3,5-diamine.
| Compound Name | 4-[1,2-bis(benzenesulfonyl)ethyl]-4H-pyrazole-3,5-diamine |
|---|---|
| PubChem CID | 44517063 |
| Molecular Formula | C17H18N4O4S2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | 4-[1,2-bis(benzenesulfonyl)ethyl]-4H-pyrazole-3,5-diamine |
| SMILES | NC1=NN=C(N)C1C(CS(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H18N4O4S2/c18-16-15(17(19)21-20-16)14(27(24,25)13-9-5-2-6-10-13)11-26(22,23)12-7-3-1-4-8-12/h1-10,14-15H,11H2,(H2,18,20)(H2,19,21) |
| InChIKey | FVIGCAHLQFLQSS-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 145.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |