About [2-di(propan-2-yloxy)phosphoryl-2,2-difluoroethyl] trifluoromethanesulfonate
[2-di(propan-2-yloxy)phosphoryl-2,2-difluoroethyl] trifluoromethanesulfonate (PubChem CID 44517132) has the molecular formula C9H16F5O6PS
and a molecular weight of 378.25 g/mol. Its IUPAC name is [2-di(propan-2-yloxy)phosphoryl-2,2-difluoroethyl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [2-di(propan-2-yloxy)phosphoryl-2,2-difluoroethyl] trifluoromethanesulfonate |
| PubChem CID | 44517132 |
| Molecular Formula | C9H16F5O6PS |
| Molecular Weight | 378.25 g/mol |
| Exact Mass | 378.03 |
| IUPAC Name | [2-di(propan-2-yloxy)phosphoryl-2,2-difluoroethyl] trifluoromethanesulfonate |
| SMILES | CC(C)OP(=O)(OC(C)C)C(F)(F)COS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C9H16F5O6PS/c1-6(2)19-21(15,20-7(3)4)8(10,11)5-18-22(16,17)9(12,13)14/h6-7H,5H2,1-4H3 |
| InChIKey | ACLYOQBKIVGACZ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.25 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [2-di(propan-2-yloxy)phosphoryl-2,2-difluoroethyl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-di(propan-2-yloxy)phosphoryl-2,2-difluoroethyl] trifluoromethanesulfonate?
The IUPAC name of [2-di(propan-2-yloxy)phosphoryl-2,2-difluoroethyl] trifluoromethanesulfonate (CID 44517132) is [2-di(propan-2-yloxy)phosphoryl-2,2-difluoroethyl] trifluoromethanesulfonate.
What is the SMILES notation for [2-di(propan-2-yloxy)phosphoryl-2,2-difluoroethyl] trifluoromethanesulfonate?
The canonical SMILES for [2-di(propan-2-yloxy)phosphoryl-2,2-difluoroethyl] trifluoromethanesulfonate is CC(C)OP(=O)(OC(C)C)C(F)(F)COS(=O)(=O)C(F)(F)F.
What is the InChIKey of [2-di(propan-2-yloxy)phosphoryl-2,2-difluoroethyl] trifluoromethanesulfonate?
The InChIKey is ACLYOQBKIVGACZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16F5O6PS/c1-6(2)19-21(15,20-7(3)4)8(10,11)5-18-22(16,17)9(12,13)14/h6-7H,5H2,1-4H3.
What are the key properties of [2-di(propan-2-yloxy)phosphoryl-2,2-difluoroethyl] trifluoromethanesulfonate?
[2-di(propan-2-yloxy)phosphoryl-2,2-difluoroethyl] trifluoromethanesulfonate has a molecular weight of 378.25 g/mol, XLogP of 3.49, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-di(propan-2-yloxy)phosphoryl-2,2-difluoroethyl] trifluoromethanesulfonate is sourced from PubChem (CID 44517132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).