C22H28N2O4 — CID 44517140
(3Z,6S)-3-[[4-[(2E)-3,7-dimethylocta-2,6-dienoxy]phenyl]methylidene]-1-hydroxy-6-methylpiperazine-2,5-dione (PubChem CID 44517140) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is (3Z,6S)-3-[[4-[(2E)-3,7-dimethylocta-2,6-dienoxy]phenyl]methylidene]-1-hydroxy-6-methylpiperazine-2,5-dione.
| Compound Name | (3Z,6S)-3-[[4-[(2E)-3,7-dimethylocta-2,6-dienoxy]phenyl]methylidene]-1-hydroxy-6-methylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 44517140 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | (3Z,6S)-3-[[4-[(2E)-3,7-dimethylocta-2,6-dienoxy]phenyl]methylidene]-1-hydroxy-6-methylpiperazine-2,5-dione |
| SMILES | CC(C)=CCC/C(C)=C/COc1ccc(/C=C2\NC(=O)[C@H](C)N(O)C2=O)cc1 |
| InChI | InChI=1S/C22H28N2O4/c1-15(2)6-5-7-16(3)12-13-28-19-10-8-18(9-11-19)14-20-22(26)24(27)17(4)21(25)23-20/h6,8-12,14,17,27H,5,7,13H2,1-4H3,(H,23,25)/b16-12+,20-14-/t17-/m0/s1 |
| InChIKey | FMVPWWRMFNNRRJ-ITZIZTMESA-N |
| XLogP | 3.84 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|