About 8-(2,6-difluoro-3,5-dimethoxyphenyl)-N-pyridin-2-ylquinoxaline-5-carboxamide
8-(2,6-difluoro-3,5-dimethoxyphenyl)-N-pyridin-2-ylquinoxaline-5-carboxamide (PubChem CID 44517258) has the molecular formula C22H16F2N4O3
and a molecular weight of 422.39 g/mol. Its IUPAC name is 8-(2,6-difluoro-3,5-dimethoxyphenyl)-N-pyridin-2-ylquinoxaline-5-carboxamide.
Molecular Properties
| Compound Name | 8-(2,6-difluoro-3,5-dimethoxyphenyl)-N-pyridin-2-ylquinoxaline-5-carboxamide |
| PubChem CID | 44517258 |
| Molecular Formula | C22H16F2N4O3 |
| Molecular Weight | 422.39 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | 8-(2,6-difluoro-3,5-dimethoxyphenyl)-N-pyridin-2-ylquinoxaline-5-carboxamide |
| SMILES | COc1cc(OC)c(F)c(-c2ccc(C(=O)Nc3ccccn3)c3nccnc23)c1F |
| InChI | InChI=1S/C22H16F2N4O3/c1-30-14-11-15(31-2)19(24)17(18(14)23)12-6-7-13(21-20(12)26-9-10-27-21)22(29)28-16-5-3-4-8-25-16/h3-11H,1-2H3,(H,25,28,29) |
| InChIKey | WRJQESMYYXWRAN-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.39 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 8-(2,6-difluoro-3,5-dimethoxyphenyl)-N-pyridin-2-ylquinoxaline-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(2,6-difluoro-3,5-dimethoxyphenyl)-N-pyridin-2-ylquinoxaline-5-carboxamide?
The IUPAC name of 8-(2,6-difluoro-3,5-dimethoxyphenyl)-N-pyridin-2-ylquinoxaline-5-carboxamide (CID 44517258) is 8-(2,6-difluoro-3,5-dimethoxyphenyl)-N-pyridin-2-ylquinoxaline-5-carboxamide.
What is the SMILES notation for 8-(2,6-difluoro-3,5-dimethoxyphenyl)-N-pyridin-2-ylquinoxaline-5-carboxamide?
The canonical SMILES for 8-(2,6-difluoro-3,5-dimethoxyphenyl)-N-pyridin-2-ylquinoxaline-5-carboxamide is COc1cc(OC)c(F)c(-c2ccc(C(=O)Nc3ccccn3)c3nccnc23)c1F.
What is the InChIKey of 8-(2,6-difluoro-3,5-dimethoxyphenyl)-N-pyridin-2-ylquinoxaline-5-carboxamide?
The InChIKey is WRJQESMYYXWRAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16F2N4O3/c1-30-14-11-15(31-2)19(24)17(18(14)23)12-6-7-13(21-20(12)26-9-10-27-21)22(29)28-16-5-3-4-8-25-16/h3-11H,1-2H3,(H,25,28,29).
What are the key properties of 8-(2,6-difluoro-3,5-dimethoxyphenyl)-N-pyridin-2-ylquinoxaline-5-carboxamide?
8-(2,6-difluoro-3,5-dimethoxyphenyl)-N-pyridin-2-ylquinoxaline-5-carboxamide has a molecular weight of 422.39 g/mol, XLogP of 4.24, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(2,6-difluoro-3,5-dimethoxyphenyl)-N-pyridin-2-ylquinoxaline-5-carboxamide is sourced from PubChem (CID 44517258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).