About 4-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyridine-2,6-diamine
4-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyridine-2,6-diamine (PubChem CID 44517344) has the molecular formula C12H11N5
and a molecular weight of 225.26 g/mol. Its IUPAC name is 4-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyridine-2,6-diamine.
Molecular Properties
| Compound Name | 4-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyridine-2,6-diamine |
| PubChem CID | 44517344 |
| Molecular Formula | C12H11N5 |
| Molecular Weight | 225.26 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 4-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyridine-2,6-diamine |
| SMILES | Nc1cc(-c2c[nH]c3ncccc23)cc(N)n1 |
| InChI | InChI=1S/C12H11N5/c13-10-4-7(5-11(14)17-10)9-6-16-12-8(9)2-1-3-15-12/h1-6H,(H,15,16)(H4,13,14,17) |
| InChIKey | CUYZMHANGROXFG-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.26 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyridine-2,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyridine-2,6-diamine?
The IUPAC name of 4-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyridine-2,6-diamine (CID 44517344) is 4-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyridine-2,6-diamine.
What is the SMILES notation for 4-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyridine-2,6-diamine?
The canonical SMILES for 4-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyridine-2,6-diamine is Nc1cc(-c2c[nH]c3ncccc23)cc(N)n1.
What is the InChIKey of 4-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyridine-2,6-diamine?
The InChIKey is CUYZMHANGROXFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N5/c13-10-4-7(5-11(14)17-10)9-6-16-12-8(9)2-1-3-15-12/h1-6H,(H,15,16)(H4,13,14,17).
What are the key properties of 4-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyridine-2,6-diamine?
4-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyridine-2,6-diamine has a molecular weight of 225.26 g/mol, XLogP of 1.79, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyridine-2,6-diamine is sourced from PubChem (CID 44517344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).