C16H15F2N5O2 — CID 44517636
6-(2,4-difluorophenoxy)-N-(oxan-4-yl)-1H-pyrazolo[3,4-d]pyrimidin-3-amine (PubChem CID 44517636) has the molecular formula C16H15F2N5O2 and a molecular weight of 347.33 g/mol. Its IUPAC name is 6-(2,4-difluorophenoxy)-N-(oxan-4-yl)-1H-pyrazolo[3,4-d]pyrimidin-3-amine.
| Compound Name | 6-(2,4-difluorophenoxy)-N-(oxan-4-yl)-1H-pyrazolo[3,4-d]pyrimidin-3-amine |
|---|---|
| PubChem CID | 44517636 |
| Molecular Formula | C16H15F2N5O2 |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 6-(2,4-difluorophenoxy)-N-(oxan-4-yl)-1H-pyrazolo[3,4-d]pyrimidin-3-amine |
| SMILES | Fc1ccc(Oc2ncc3c(NC4CCOCC4)n[nH]c3n2)c(F)c1 |
| InChI | InChI=1S/C16H15F2N5O2/c17-9-1-2-13(12(18)7-9)25-16-19-8-11-14(22-23-15(11)21-16)20-10-3-5-24-6-4-10/h1-2,7-8,10H,3-6H2,(H2,19,20,21,22,23) |
| InChIKey | LOAPRHLXCJAODL-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 84.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |