2-[5-(2-fluorophenyl)-1,2,4-oxadiazol-3-yl]benzoic acid

C15H9FN2O3 — CID 44517658

IUPAC2-[5-(2-fluorophenyl)-1,2,4-oxadiazol-3-yl]benzoic acid
SMILESO=C(O)c1ccccc1-c1noc(-c2ccccc2F)n1
InChIInChI=1S/C15H9FN2O3/c16-12-8-4-3-7-11(12)14-17-13(18-21-14)9-5-1-2-6-10(9)15(19)20/h1-8H,(H,19,20)
InChIKeyGPZQHEQWDRYNJH-UHFFFAOYSA-N
MW284.25 g/mol
LogP3.24
Rot. Bonds3

About 2-[5-(2-fluorophenyl)-1,2,4-oxadiazol-3-yl]benzoic acid

2-[5-(2-fluorophenyl)-1,2,4-oxadiazol-3-yl]benzoic acid (PubChem CID 44517658) has the molecular formula C15H9FN2O3 and a molecular weight of 284.25 g/mol. Its IUPAC name is 2-[5-(2-fluorophenyl)-1,2,4-oxadiazol-3-yl]benzoic acid.

Molecular Properties

Compound Name2-[5-(2-fluorophenyl)-1,2,4-oxadiazol-3-yl]benzoic acid
PubChem CID44517658
Molecular FormulaC15H9FN2O3
Molecular Weight284.25 g/mol
Exact Mass284.06
IUPAC Name2-[5-(2-fluorophenyl)-1,2,4-oxadiazol-3-yl]benzoic acid
SMILESO=C(O)c1ccccc1-c1noc(-c2ccccc2F)n1
InChIInChI=1S/C15H9FN2O3/c16-12-8-4-3-7-11(12)14-17-13(18-21-14)9-5-1-2-6-10(9)15(19)20/h1-8H,(H,19,20)
InChIKeyGPZQHEQWDRYNJH-UHFFFAOYSA-N
XLogP3.24
TPSA76.22 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500284.25
LogP ≤ 53.24
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-[5-(2-fluorophenyl)-1,2,4-oxadiazol-3-yl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[5-(2-fluorophenyl)-1,2,4-oxadiazol-3-yl]benzoic acid?
The IUPAC name of 2-[5-(2-fluorophenyl)-1,2,4-oxadiazol-3-yl]benzoic acid (CID 44517658) is 2-[5-(2-fluorophenyl)-1,2,4-oxadiazol-3-yl]benzoic acid.
What is the SMILES notation for 2-[5-(2-fluorophenyl)-1,2,4-oxadiazol-3-yl]benzoic acid?
The canonical SMILES for 2-[5-(2-fluorophenyl)-1,2,4-oxadiazol-3-yl]benzoic acid is O=C(O)c1ccccc1-c1noc(-c2ccccc2F)n1.
What is the InChIKey of 2-[5-(2-fluorophenyl)-1,2,4-oxadiazol-3-yl]benzoic acid?
The InChIKey is GPZQHEQWDRYNJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9FN2O3/c16-12-8-4-3-7-11(12)14-17-13(18-21-14)9-5-1-2-6-10(9)15(19)20/h1-8H,(H,19,20).
What are the key properties of 2-[5-(2-fluorophenyl)-1,2,4-oxadiazol-3-yl]benzoic acid?
2-[5-(2-fluorophenyl)-1,2,4-oxadiazol-3-yl]benzoic acid has a molecular weight of 284.25 g/mol, XLogP of 3.24, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(2-fluorophenyl)-1,2,4-oxadiazol-3-yl]benzoic acid is sourced from PubChem (CID 44517658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).