C27H42O4S — CID 44517675
trans-(1R,3S,5Z)-5-[(2E)-2-[(3aS,7aS)-7a-methyl-1-[(2R)-5-propan-2-ylsulfonylpentan-2-yl]-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol (PubChem CID 44517675) has the molecular formula C27H42O4S and a molecular weight of 462.70 g/mol. Its IUPAC name is trans-(1R,3S,5Z)-5-[(2E)-2-[(3aS,7aS)-7a-methyl-1-[(2R)-5-propan-2-ylsulfonylpentan-2-yl]-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol.
| Compound Name | trans-(1R,3S,5Z)-5-[(2E)-2-[(3aS,7aS)-7a-methyl-1-[(2R)-5-propan-2-ylsulfonylpentan-2-yl]-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol |
|---|---|
| PubChem CID | 44517675 |
| Molecular Formula | C27H42O4S |
| Molecular Weight | 462.70 g/mol |
| Exact Mass | 462.28 |
| IUPAC Name | trans-(1R,3S,5Z)-5-[(2E)-2-[(3aS,7aS)-7a-methyl-1-[(2R)-5-propan-2-ylsulfonylpentan-2-yl]-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol |
| SMILES | C=C1/C(=C\C=C2/CCC[C@]3(C)C([C@H](C)CCCS(=O)(=O)C(C)C)=CC[C@@H]23)C[C@@H](O)C[C@@H]1O |
| InChI | InChI=1S/C27H42O4S/c1-18(2)32(30,31)15-7-8-19(3)24-12-13-25-21(9-6-14-27(24,25)5)10-11-22-16-23(28)17-26(29)20(22)4/h10-12,18-19,23,25-26,28-29H,4,6-9,13-17H2,1-3,5H3/b21-10+,22-11-/t19-,23-,25+,26+,27-/m1/s1 |
| InChIKey | NTTBIQLUSQTTIQ-LKSSLPMYSA-N |
| XLogP | 5.29 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.70 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|