C21H34O4 — CID 44517933
(3E,5R,8R,10S,12R)-5-hydroxy-4,8,10-trimethyl-12-[(2R)-2-methyl-3-methylidenepentyl]-1-oxacyclododec-3-ene-2,7-dione (PubChem CID 44517933) has the molecular formula C21H34O4 and a molecular weight of 350.50 g/mol. Its IUPAC name is (3E,5R,8R,10S,12R)-5-hydroxy-4,8,10-trimethyl-12-[(2R)-2-methyl-3-methylidenepentyl]-1-oxacyclododec-3-ene-2,7-dione.
| Compound Name | (3E,5R,8R,10S,12R)-5-hydroxy-4,8,10-trimethyl-12-[(2R)-2-methyl-3-methylidenepentyl]-1-oxacyclododec-3-ene-2,7-dione |
|---|---|
| PubChem CID | 44517933 |
| Molecular Formula | C21H34O4 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | (3E,5R,8R,10S,12R)-5-hydroxy-4,8,10-trimethyl-12-[(2R)-2-methyl-3-methylidenepentyl]-1-oxacyclododec-3-ene-2,7-dione |
| SMILES | C=C(CC)[C@H](C)C[C@H]1C[C@@H](C)C[C@@H](C)C(=O)C[C@@H](O)/C(C)=C/C(=O)O1 |
| InChI | InChI=1S/C21H34O4/c1-7-14(3)15(4)10-18-9-13(2)8-16(5)19(22)12-20(23)17(6)11-21(24)25-18/h11,13,15-16,18,20,23H,3,7-10,12H2,1-2,4-6H3/b17-11+/t13-,15+,16+,18+,20+/m0/s1 |
| InChIKey | RNCFACHXZBAPGG-HWOAGQIKSA-N |
| XLogP | 4.22 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|