C22H38O6Si — CID 44518040
(6S)-1-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-6-tri(propan-2-yl)silyloxyheptane-2,4-dione (PubChem CID 44518040) has the molecular formula C22H38O6Si and a molecular weight of 426.63 g/mol. Its IUPAC name is (6S)-1-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-6-tri(propan-2-yl)silyloxyheptane-2,4-dione.
| Compound Name | (6S)-1-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-6-tri(propan-2-yl)silyloxyheptane-2,4-dione |
|---|---|
| PubChem CID | 44518040 |
| Molecular Formula | C22H38O6Si |
| Molecular Weight | 426.63 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | (6S)-1-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-6-tri(propan-2-yl)silyloxyheptane-2,4-dione |
| SMILES | CC(C)[Si](O[C@@H](C)CC(=O)CC(=O)CC1=CC(=O)OC(C)(C)O1)(C(C)C)C(C)C |
| InChI | InChI=1S/C22H38O6Si/c1-14(2)29(15(3)4,16(5)6)28-17(7)10-18(23)11-19(24)12-20-13-21(25)27-22(8,9)26-20/h13-17H,10-12H2,1-9H3/t17-/m0/s1 |
| InChIKey | JIJVROSZVYIGLO-KRWDZBQOSA-N |
| XLogP | 5.07 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.63 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|