C22H30O7 — CID 44518234
6-[(3Z,5E)-8-[(4S,5R)-2,2-dimethyl-5-[(Z)-prop-1-enyl]-1,3-dioxolan-4-yl]-4-hydroxy-2-oxoocta-3,5-dienyl]-2,2-dimethyl-1,3-dioxin-4-one (PubChem CID 44518234) has the molecular formula C22H30O7 and a molecular weight of 406.48 g/mol. Its IUPAC name is 6-[(3Z,5E)-8-[(4S,5R)-2,2-dimethyl-5-[(Z)-prop-1-enyl]-1,3-dioxolan-4-yl]-4-hydroxy-2-oxoocta-3,5-dienyl]-2,2-dimethyl-1,3-dioxin-4-one.
| Compound Name | 6-[(3Z,5E)-8-[(4S,5R)-2,2-dimethyl-5-[(Z)-prop-1-enyl]-1,3-dioxolan-4-yl]-4-hydroxy-2-oxoocta-3,5-dienyl]-2,2-dimethyl-1,3-dioxin-4-one |
|---|---|
| PubChem CID | 44518234 |
| Molecular Formula | C22H30O7 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | 6-[(3Z,5E)-8-[(4S,5R)-2,2-dimethyl-5-[(Z)-prop-1-enyl]-1,3-dioxolan-4-yl]-4-hydroxy-2-oxoocta-3,5-dienyl]-2,2-dimethyl-1,3-dioxin-4-one |
| SMILES | C/C=C\[C@H]1OC(C)(C)O[C@H]1CC/C=C/C(O)=C/C(=O)CC1=CC(=O)OC(C)(C)O1 |
| InChI | InChI=1S/C22H30O7/c1-6-9-18-19(28-22(4,5)27-18)11-8-7-10-15(23)12-16(24)13-17-14-20(25)29-21(2,3)26-17/h6-7,9-10,12,14,18-19,23H,8,11,13H2,1-5H3/b9-6-,10-7+,15-12-/t18-,19+/m1/s1 |
| InChIKey | QHNHZXMBINQFLM-NIMXQKFQSA-N |
| XLogP | 4.01 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|