C9H11ClO4 — CID 44518403
2-chloroethyl (1R,2S,4R,5S,6R)-3,8-dioxatricyclo[3.2.1.02,4]octane-6-carboxylate (PubChem CID 44518403) has the molecular formula C9H11ClO4 and a molecular weight of 218.64 g/mol. Its IUPAC name is 2-chloroethyl (1R,2S,4R,5S,6R)-3,8-dioxatricyclo[3.2.1.02,4]octane-6-carboxylate.
| Compound Name | 2-chloroethyl (1R,2S,4R,5S,6R)-3,8-dioxatricyclo[3.2.1.02,4]octane-6-carboxylate |
|---|---|
| PubChem CID | 44518403 |
| Molecular Formula | C9H11ClO4 |
| Molecular Weight | 218.64 g/mol |
| Exact Mass | 218.03 |
| IUPAC Name | 2-chloroethyl (1R,2S,4R,5S,6R)-3,8-dioxatricyclo[3.2.1.02,4]octane-6-carboxylate |
| SMILES | O=C(OCCCl)[C@@H]1C[C@H]2O[C@@H]1[C@H]1O[C@H]12 |
| InChI | InChI=1S/C9H11ClO4/c10-1-2-12-9(11)4-3-5-7-8(14-7)6(4)13-5/h4-8H,1-3H2/t4-,5-,6+,7+,8-/m1/s1 |
| InChIKey | QOUOIIPLVCRWPA-QQGCVABSSA-N |
| XLogP | 0.32 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.64 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|