C19H19NO4 — CID 44518528
3-methyl-8-nitro-1,2,3,4,6,6a,12a,12b-octahydrobenzo[a]anthracene-7,12-dione (PubChem CID 44518528) has the molecular formula C19H19NO4 and a molecular weight of 325.36 g/mol. Its IUPAC name is 3-methyl-8-nitro-1,2,3,4,6,6a,12a,12b-octahydrobenzo[a]anthracene-7,12-dione.
| Compound Name | 3-methyl-8-nitro-1,2,3,4,6,6a,12a,12b-octahydrobenzo[a]anthracene-7,12-dione |
|---|---|
| PubChem CID | 44518528 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 3-methyl-8-nitro-1,2,3,4,6,6a,12a,12b-octahydrobenzo[a]anthracene-7,12-dione |
| SMILES | CC1CCC2C(=CCC3C(=O)c4c(cccc4[N+](=O)[O-])C(=O)C32)C1 |
| InChI | InChI=1S/C19H19NO4/c1-10-5-7-12-11(9-10)6-8-14-16(12)18(21)13-3-2-4-15(20(23)24)17(13)19(14)22/h2-4,6,10,12,14,16H,5,7-9H2,1H3 |
| InChIKey | QPADBHNLABVPPI-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|