C39H43N3O4Si — CID 44518551
(2R,3S,4R,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[2-(dibenzylamino)pyrimidin-5-yl]oxolane-3,4-diol (PubChem CID 44518551) has the molecular formula C39H43N3O4Si and a molecular weight of 645.88 g/mol. Its IUPAC name is (2R,3S,4R,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[2-(dibenzylamino)pyrimidin-5-yl]oxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[2-(dibenzylamino)pyrimidin-5-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 44518551 |
| Molecular Formula | C39H43N3O4Si |
| Molecular Weight | 645.88 g/mol |
| Exact Mass | 645.30 |
| IUPAC Name | (2R,3S,4R,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[2-(dibenzylamino)pyrimidin-5-yl]oxolane-3,4-diol |
| SMILES | CC(C)(C)[Si](OC[C@H]1O[C@@H](c2cnc(N(Cc3ccccc3)Cc3ccccc3)nc2)[C@H](O)[C@@H]1O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C39H43N3O4Si/c1-39(2,3)47(32-20-12-6-13-21-32,33-22-14-7-15-23-33)45-28-34-35(43)36(44)37(46-34)31-24-40-38(41-25-31)42(26-29-16-8-4-9-17-29)27-30-18-10-5-11-19-30/h4-25,34-37,43-44H,26-28H2,1-3H3/t34-,35-,36-,37+/m1/s1 |
| InChIKey | PMJYACSCRBKCSS-BWFYGAPHSA-N |
| XLogP | 5.42 |
| TPSA | 87.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.88 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|