C29H31N3O7 — CID 44518709
[(2R,3R,4S,5S)-3,4-diacetyloxy-5-[2-(dibenzylamino)pyrimidin-5-yl]oxolan-2-yl]methyl acetate (PubChem CID 44518709) has the molecular formula C29H31N3O7 and a molecular weight of 533.58 g/mol. Its IUPAC name is [(2R,3R,4S,5S)-3,4-diacetyloxy-5-[2-(dibenzylamino)pyrimidin-5-yl]oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5S)-3,4-diacetyloxy-5-[2-(dibenzylamino)pyrimidin-5-yl]oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 44518709 |
| Molecular Formula | C29H31N3O7 |
| Molecular Weight | 533.58 g/mol |
| Exact Mass | 533.22 |
| IUPAC Name | [(2R,3R,4S,5S)-3,4-diacetyloxy-5-[2-(dibenzylamino)pyrimidin-5-yl]oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](c2cnc(N(Cc3ccccc3)Cc3ccccc3)nc2)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C29H31N3O7/c1-19(33)36-18-25-27(37-20(2)34)28(38-21(3)35)26(39-25)24-14-30-29(31-15-24)32(16-22-10-6-4-7-11-22)17-23-12-8-5-9-13-23/h4-15,25-28H,16-18H2,1-3H3/t25-,26+,27-,28+/m1/s1 |
| InChIKey | YLWJJOBTRXLROB-GCFVYEKYSA-N |
| XLogP | 3.55 |
| TPSA | 117.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.58 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|