C29H25NO2 — CID 44518726
17-(4-nitrophenyl)pentacyclo[14.7.0.02,7.08,15.018,23]tricosa-1(16),2,4,6,8(15),18,20,22-octaene (PubChem CID 44518726) has the molecular formula C29H25NO2 and a molecular weight of 419.52 g/mol. Its IUPAC name is 17-(4-nitrophenyl)pentacyclo[14.7.0.02,7.08,15.018,23]tricosa-1(16),2,4,6,8(15),18,20,22-octaene.
| Compound Name | 17-(4-nitrophenyl)pentacyclo[14.7.0.02,7.08,15.018,23]tricosa-1(16),2,4,6,8(15),18,20,22-octaene |
|---|---|
| PubChem CID | 44518726 |
| Molecular Formula | C29H25NO2 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | 17-(4-nitrophenyl)pentacyclo[14.7.0.02,7.08,15.018,23]tricosa-1(16),2,4,6,8(15),18,20,22-octaene |
| SMILES | O=[N+]([O-])c1ccc(C2c3ccccc3-c3c2c2c(c4ccccc34)CCCCCC2)cc1 |
| InChI | InChI=1S/C29H25NO2/c31-30(32)20-17-15-19(16-18-20)27-25-13-7-8-14-26(25)28-23-12-6-5-10-21(23)22-9-3-1-2-4-11-24(22)29(27)28/h5-8,10,12-18,27H,1-4,9,11H2 |
| InChIKey | AGVVMNNJJCDIGU-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|