C33H30BrNO6 — CID 44518853
4-O-(anthracen-9-ylmethyl) 2-O,2-O'-diethyl 5-(4-bromophenyl)-3-methylidenepyrrolidine-2,2,4-tricarboxylate (PubChem CID 44518853) has the molecular formula C33H30BrNO6 and a molecular weight of 616.51 g/mol. Its IUPAC name is 4-O-(anthracen-9-ylmethyl) 2-O,2-O'-diethyl 5-(4-bromophenyl)-3-methylidenepyrrolidine-2,2,4-tricarboxylate.
| Compound Name | 4-O-(anthracen-9-ylmethyl) 2-O,2-O'-diethyl 5-(4-bromophenyl)-3-methylidenepyrrolidine-2,2,4-tricarboxylate |
|---|---|
| PubChem CID | 44518853 |
| Molecular Formula | C33H30BrNO6 |
| Molecular Weight | 616.51 g/mol |
| Exact Mass | 615.13 |
| IUPAC Name | 4-O-(anthracen-9-ylmethyl) 2-O,2-O'-diethyl 5-(4-bromophenyl)-3-methylidenepyrrolidine-2,2,4-tricarboxylate |
| SMILES | C=C1C(C(=O)OCc2c3ccccc3cc3ccccc23)C(c2ccc(Br)cc2)NC1(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C33H30BrNO6/c1-4-39-31(37)33(32(38)40-5-2)20(3)28(29(35-33)21-14-16-24(34)17-15-21)30(36)41-19-27-25-12-8-6-10-22(25)18-23-11-7-9-13-26(23)27/h6-18,28-29,35H,3-5,19H2,1-2H3 |
| InChIKey | IIJXDHGCKKFVOZ-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.51 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|