C15H22O2 — CID 44518873
(1R,8S,9S,11R)-3,7,9,11-tetramethyl-12-oxatricyclo[6.3.1.01,6]dodec-6-en-10-one (PubChem CID 44518873) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is (1R,8S,9S,11R)-3,7,9,11-tetramethyl-12-oxatricyclo[6.3.1.01,6]dodec-6-en-10-one.
| Compound Name | (1R,8S,9S,11R)-3,7,9,11-tetramethyl-12-oxatricyclo[6.3.1.01,6]dodec-6-en-10-one |
|---|---|
| PubChem CID | 44518873 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | (1R,8S,9S,11R)-3,7,9,11-tetramethyl-12-oxatricyclo[6.3.1.01,6]dodec-6-en-10-one |
| SMILES | CC1=C2CCC(C)C[C@]23O[C@H]1[C@H](C)C(=O)[C@@H]3C |
| InChI | InChI=1S/C15H22O2/c1-8-5-6-12-9(2)14-10(3)13(16)11(4)15(12,7-8)17-14/h8,10-11,14H,5-7H2,1-4H3/t8?,10-,11+,14-,15-/m1/s1 |
| InChIKey | LSOXNOSWTCYVDM-NSHYAWMMSA-N |
| XLogP | 3.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|