C11H16O5 — CID 44518911
dimethyl 2-methyl-5-methylideneoxane-4,4-dicarboxylate (PubChem CID 44518911) has the molecular formula C11H16O5 and a molecular weight of 228.24 g/mol. Its IUPAC name is dimethyl 2-methyl-5-methylideneoxane-4,4-dicarboxylate.
| Compound Name | dimethyl 2-methyl-5-methylideneoxane-4,4-dicarboxylate |
|---|---|
| PubChem CID | 44518911 |
| Molecular Formula | C11H16O5 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | dimethyl 2-methyl-5-methylideneoxane-4,4-dicarboxylate |
| SMILES | C=C1COC(C)CC1(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C11H16O5/c1-7-6-16-8(2)5-11(7,9(12)14-3)10(13)15-4/h8H,1,5-6H2,2-4H3 |
| InChIKey | HWUVWIXQXXEVHF-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|