C32H40N2O2 — CID 44519200
7-(4-methylphenyl)-N-[4-methyl-3-(2-pyrrolidin-1-ylethoxy)phenyl]-3,4,4a,7,8,9-hexahydro-2H-benzo[7]annulene-1-carboxamide (PubChem CID 44519200) has the molecular formula C32H40N2O2 and a molecular weight of 484.68 g/mol. Its IUPAC name is 7-(4-methylphenyl)-N-[4-methyl-3-(2-pyrrolidin-1-ylethoxy)phenyl]-3,4,4a,7,8,9-hexahydro-2H-benzo[7]annulene-1-carboxamide.
| Compound Name | 7-(4-methylphenyl)-N-[4-methyl-3-(2-pyrrolidin-1-ylethoxy)phenyl]-3,4,4a,7,8,9-hexahydro-2H-benzo[7]annulene-1-carboxamide |
|---|---|
| PubChem CID | 44519200 |
| Molecular Formula | C32H40N2O2 |
| Molecular Weight | 484.68 g/mol |
| Exact Mass | 484.31 |
| IUPAC Name | 7-(4-methylphenyl)-N-[4-methyl-3-(2-pyrrolidin-1-ylethoxy)phenyl]-3,4,4a,7,8,9-hexahydro-2H-benzo[7]annulene-1-carboxamide |
| SMILES | Cc1ccc(C2C=CC3CCCC(C(=O)Nc4ccc(C)c(OCCN5CCCC5)c4)=C3CC2)cc1 |
| InChI | InChI=1S/C32H40N2O2/c1-23-8-11-25(12-9-23)26-13-14-27-6-5-7-30(29(27)17-15-26)32(35)33-28-16-10-24(2)31(22-28)36-21-20-34-18-3-4-19-34/h8-14,16,22,26-27H,3-7,15,17-21H2,1-2H3,(H,33,35) |
| InChIKey | NBHWZJNOGFAYTE-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.68 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|