C19H20F3O3P — CID 44519440
[(E)-1-diethoxyphosphoryl-3,3,3-trifluoro-1-phenylprop-1-en-2-yl]benzene (PubChem CID 44519440) has the molecular formula C19H20F3O3P and a molecular weight of 384.33 g/mol. Its IUPAC name is [(E)-1-diethoxyphosphoryl-3,3,3-trifluoro-1-phenylprop-1-en-2-yl]benzene.
| Compound Name | [(E)-1-diethoxyphosphoryl-3,3,3-trifluoro-1-phenylprop-1-en-2-yl]benzene |
|---|---|
| PubChem CID | 44519440 |
| Molecular Formula | C19H20F3O3P |
| Molecular Weight | 384.33 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | [(E)-1-diethoxyphosphoryl-3,3,3-trifluoro-1-phenylprop-1-en-2-yl]benzene |
| SMILES | CCOP(=O)(OCC)/C(=C(\c1ccccc1)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C19H20F3O3P/c1-3-24-26(23,25-4-2)18(16-13-9-6-10-14-16)17(19(20,21)22)15-11-7-5-8-12-15/h5-14H,3-4H2,1-2H3/b18-17+ |
| InChIKey | CQCGBWIFUXLGSS-ISLYRVAYSA-N |
| XLogP | 6.38 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.33 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|