C25H18I2N4O10S2 — CID 44519461
4-[3-hydroxy-4-[(1E,3E,5E,7Z)-7-[1-(2-(125I)iodo-4-sulfophenyl)-3,5-dioxopyrazolidin-4-ylidene]hepta-1,3,5-trienyl]-5-oxo-1H-pyrazol-2-yl]-3-(125I)iodobenzenesulfonic acid (PubChem CID 44519461) has the molecular formula C25H18I2N4O10S2 and a molecular weight of 848.38 g/mol. Its IUPAC name is 4-[3-hydroxy-4-[(1E,3E,5E,7Z)-7-[1-(2-(125I)iodo-4-sulfophenyl)-3,5-dioxopyrazolidin-4-ylidene]hepta-1,3,5-trienyl]-5-oxo-1H-pyrazol-2-yl]-3-(125I)iodobenzenesulfonic acid.
| Compound Name | 4-[3-hydroxy-4-[(1E,3E,5E,7Z)-7-[1-(2-(125I)iodo-4-sulfophenyl)-3,5-dioxopyrazolidin-4-ylidene]hepta-1,3,5-trienyl]-5-oxo-1H-pyrazol-2-yl]-3-(125I)iodobenzenesulfonic acid |
|---|---|
| PubChem CID | 44519461 |
| Molecular Formula | C25H18I2N4O10S2 |
| Molecular Weight | 848.38 g/mol |
| Exact Mass | 847.86 |
| IUPAC Name | 4-[3-hydroxy-4-[(1E,3E,5E,7Z)-7-[1-(2-(125I)iodo-4-sulfophenyl)-3,5-dioxopyrazolidin-4-ylidene]hepta-1,3,5-trienyl]-5-oxo-1H-pyrazol-2-yl]-3-(125I)iodobenzenesulfonic acid |
| SMILES | O=C1NN(c2ccc(S(=O)(=O)O)cc2[125I])C(=O)/C1=C\C=C\C=C\C=C\c1c(O)n(-c2ccc(S(=O)(=O)O)cc2[125I])[nH]c1=O |
| InChI | InChI=1S/C25H18I2N4O10S2/c26-18-12-14(42(36,37)38)8-10-20(18)30-24(34)16(22(32)28-30)6-4-2-1-3-5-7-17-23(33)29-31(25(17)35)21-11-9-15(13-19(21)27)43(39,40)41/h1-13,34H,(H,28,32)(H,29,33)(H,36,37,38)(H,39,40,41)/b2-1+,5-3+,6-4+,17-7-/i26-2,27-2 |
| InChIKey | JHNGSEPNRTXURY-CGEYUWGYSA-N |
| XLogP | 2.70 |
| TPSA | 216.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 848.38 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|