C19H24N2O3 — CID 44520141
(15S,17R,19S)-15-ethyl-17-hydroxy-1,11-diazatetracyclo[9.6.2.02,7.015,19]nonadeca-2,4,6-triene-8,18-dione (PubChem CID 44520141) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is (15S,17R,19S)-15-ethyl-17-hydroxy-1,11-diazatetracyclo[9.6.2.02,7.015,19]nonadeca-2,4,6-triene-8,18-dione.
| Compound Name | (15S,17R,19S)-15-ethyl-17-hydroxy-1,11-diazatetracyclo[9.6.2.02,7.015,19]nonadeca-2,4,6-triene-8,18-dione |
|---|---|
| PubChem CID | 44520141 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | (15S,17R,19S)-15-ethyl-17-hydroxy-1,11-diazatetracyclo[9.6.2.02,7.015,19]nonadeca-2,4,6-triene-8,18-dione |
| SMILES | CC[C@@]12CCCN3CCC(=O)c4ccccc4N(C(=O)[C@@H]31)[C@H](O)C2 |
| InChI | InChI=1S/C19H24N2O3/c1-2-19-9-5-10-20-11-8-15(22)13-6-3-4-7-14(13)21(16(23)12-19)18(24)17(19)20/h3-4,6-7,16-17,23H,2,5,8-12H2,1H3/t16-,17-,19+/m1/s1 |
| InChIKey | QUTCWFPVUVMVTM-LMMKCTJWSA-N |
| XLogP | 2.19 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |