C20H42O4Si — CID 44520613
(2R,4R,6R)-4-(methoxymethoxy)-2,6-dimethyl-7-tri(propan-2-yl)silyloxyheptanal (PubChem CID 44520613) has the molecular formula C20H42O4Si and a molecular weight of 374.64 g/mol. Its IUPAC name is (2R,4R,6R)-4-(methoxymethoxy)-2,6-dimethyl-7-tri(propan-2-yl)silyloxyheptanal.
| Compound Name | (2R,4R,6R)-4-(methoxymethoxy)-2,6-dimethyl-7-tri(propan-2-yl)silyloxyheptanal |
|---|---|
| PubChem CID | 44520613 |
| Molecular Formula | C20H42O4Si |
| Molecular Weight | 374.64 g/mol |
| Exact Mass | 374.29 |
| IUPAC Name | (2R,4R,6R)-4-(methoxymethoxy)-2,6-dimethyl-7-tri(propan-2-yl)silyloxyheptanal |
| SMILES | COCO[C@H](C[C@@H](C)CO[Si](C(C)C)(C(C)C)C(C)C)C[C@@H](C)C=O |
| InChI | InChI=1S/C20H42O4Si/c1-15(2)25(16(3)4,17(5)6)24-13-19(8)11-20(23-14-22-9)10-18(7)12-21/h12,15-20H,10-11,13-14H2,1-9H3/t18-,19-,20+/m1/s1 |
| InChIKey | GWRJFXWZUZTALN-AQNXPRMDSA-N |
| XLogP | 5.42 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.64 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|