About 4-[2-amino-5-(1,3-benzodioxol-4-yl)-3-pyridinyl]benzamide
4-[2-amino-5-(1,3-benzodioxol-4-yl)-3-pyridinyl]benzamide (PubChem CID 44520783) has the molecular formula C19H15N3O3
and a molecular weight of 333.35 g/mol. Its IUPAC name is 4-[2-amino-5-(1,3-benzodioxol-4-yl)-3-pyridinyl]benzamide.
Molecular Properties
| Compound Name | 4-[2-amino-5-(1,3-benzodioxol-4-yl)-3-pyridinyl]benzamide |
| PubChem CID | 44520783 |
| Molecular Formula | C19H15N3O3 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 4-[2-amino-5-(1,3-benzodioxol-4-yl)-3-pyridinyl]benzamide |
| SMILES | NC(=O)c1ccc(-c2cc(-c3cccc4c3OCO4)cnc2N)cc1 |
| InChI | InChI=1S/C19H15N3O3/c20-18-15(11-4-6-12(7-5-11)19(21)23)8-13(9-22-18)14-2-1-3-16-17(14)25-10-24-16/h1-9H,10H2,(H2,20,22)(H2,21,23) |
| InChIKey | UBOGEBHIZSQBBD-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 100.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[2-amino-5-(1,3-benzodioxol-4-yl)-3-pyridinyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-amino-5-(1,3-benzodioxol-4-yl)-3-pyridinyl]benzamide?
The IUPAC name of 4-[2-amino-5-(1,3-benzodioxol-4-yl)-3-pyridinyl]benzamide (CID 44520783) is 4-[2-amino-5-(1,3-benzodioxol-4-yl)-3-pyridinyl]benzamide.
What is the SMILES notation for 4-[2-amino-5-(1,3-benzodioxol-4-yl)-3-pyridinyl]benzamide?
The canonical SMILES for 4-[2-amino-5-(1,3-benzodioxol-4-yl)-3-pyridinyl]benzamide is NC(=O)c1ccc(-c2cc(-c3cccc4c3OCO4)cnc2N)cc1.
What is the InChIKey of 4-[2-amino-5-(1,3-benzodioxol-4-yl)-3-pyridinyl]benzamide?
The InChIKey is UBOGEBHIZSQBBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15N3O3/c20-18-15(11-4-6-12(7-5-11)19(21)23)8-13(9-22-18)14-2-1-3-16-17(14)25-10-24-16/h1-9H,10H2,(H2,20,22)(H2,21,23).
What are the key properties of 4-[2-amino-5-(1,3-benzodioxol-4-yl)-3-pyridinyl]benzamide?
4-[2-amino-5-(1,3-benzodioxol-4-yl)-3-pyridinyl]benzamide has a molecular weight of 333.35 g/mol, XLogP of 2.83, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-amino-5-(1,3-benzodioxol-4-yl)-3-pyridinyl]benzamide is sourced from PubChem (CID 44520783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).