About 5-chloro-N-[4-(1,2-dihydroxyethyl)-3-(trifluoromethyl)phenyl]-1H-indole-2-carboxamide
5-chloro-N-[4-(1,2-dihydroxyethyl)-3-(trifluoromethyl)phenyl]-1H-indole-2-carboxamide (PubChem CID 44520840) has the molecular formula C18H14ClF3N2O3
and a molecular weight of 398.77 g/mol. Its IUPAC name is 5-chloro-N-[4-(1,2-dihydroxyethyl)-3-(trifluoromethyl)phenyl]-1H-indole-2-carboxamide.
Molecular Properties
| Compound Name | 5-chloro-N-[4-(1,2-dihydroxyethyl)-3-(trifluoromethyl)phenyl]-1H-indole-2-carboxamide |
| PubChem CID | 44520840 |
| Molecular Formula | C18H14ClF3N2O3 |
| Molecular Weight | 398.77 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | 5-chloro-N-[4-(1,2-dihydroxyethyl)-3-(trifluoromethyl)phenyl]-1H-indole-2-carboxamide |
| SMILES | O=C(Nc1ccc(C(O)CO)c(C(F)(F)F)c1)c1cc2cc(Cl)ccc2[nH]1 |
| InChI | InChI=1S/C18H14ClF3N2O3/c19-10-1-4-14-9(5-10)6-15(24-14)17(27)23-11-2-3-12(16(26)8-25)13(7-11)18(20,21)22/h1-7,16,24-26H,8H2,(H,23,27) |
| InChIKey | YWSABJGARDVRIO-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.77 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-chloro-N-[4-(1,2-dihydroxyethyl)-3-(trifluoromethyl)phenyl]-1H-indole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-N-[4-(1,2-dihydroxyethyl)-3-(trifluoromethyl)phenyl]-1H-indole-2-carboxamide?
The IUPAC name of 5-chloro-N-[4-(1,2-dihydroxyethyl)-3-(trifluoromethyl)phenyl]-1H-indole-2-carboxamide (CID 44520840) is 5-chloro-N-[4-(1,2-dihydroxyethyl)-3-(trifluoromethyl)phenyl]-1H-indole-2-carboxamide.
What is the SMILES notation for 5-chloro-N-[4-(1,2-dihydroxyethyl)-3-(trifluoromethyl)phenyl]-1H-indole-2-carboxamide?
The canonical SMILES for 5-chloro-N-[4-(1,2-dihydroxyethyl)-3-(trifluoromethyl)phenyl]-1H-indole-2-carboxamide is O=C(Nc1ccc(C(O)CO)c(C(F)(F)F)c1)c1cc2cc(Cl)ccc2[nH]1.
What is the InChIKey of 5-chloro-N-[4-(1,2-dihydroxyethyl)-3-(trifluoromethyl)phenyl]-1H-indole-2-carboxamide?
The InChIKey is YWSABJGARDVRIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14ClF3N2O3/c19-10-1-4-14-9(5-10)6-15(24-14)17(27)23-11-2-3-12(16(26)8-25)13(7-11)18(20,21)22/h1-7,16,24-26H,8H2,(H,23,27).
What are the key properties of 5-chloro-N-[4-(1,2-dihydroxyethyl)-3-(trifluoromethyl)phenyl]-1H-indole-2-carboxamide?
5-chloro-N-[4-(1,2-dihydroxyethyl)-3-(trifluoromethyl)phenyl]-1H-indole-2-carboxamide has a molecular weight of 398.77 g/mol, XLogP of 4.12, 4 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-N-[4-(1,2-dihydroxyethyl)-3-(trifluoromethyl)phenyl]-1H-indole-2-carboxamide is sourced from PubChem (CID 44520840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).