C26H31FN6O3S — CID 44520918
N-[(1R,2S,5S)-5-(dimethylcarbamoyl)-2-[(5-fluoro-1H-indole-2-carbonyl)amino]cyclohexyl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide (PubChem CID 44520918) has the molecular formula C26H31FN6O3S and a molecular weight of 526.64 g/mol. Its IUPAC name is N-[(1R,2S,5S)-5-(dimethylcarbamoyl)-2-[(5-fluoro-1H-indole-2-carbonyl)amino]cyclohexyl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide.
| Compound Name | N-[(1R,2S,5S)-5-(dimethylcarbamoyl)-2-[(5-fluoro-1H-indole-2-carbonyl)amino]cyclohexyl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 44520918 |
| Molecular Formula | C26H31FN6O3S |
| Molecular Weight | 526.64 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | N-[(1R,2S,5S)-5-(dimethylcarbamoyl)-2-[(5-fluoro-1H-indole-2-carbonyl)amino]cyclohexyl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide |
| SMILES | CN1CCc2nc(C(=O)N[C@@H]3C[C@@H](C(=O)N(C)C)CCC3NC(=O)c3cc4cc(F)ccc4[nH]3)sc2C1 |
| InChI | InChI=1S/C26H31FN6O3S/c1-32(2)26(36)14-4-6-18(29-23(34)21-12-15-10-16(27)5-7-17(15)28-21)20(11-14)30-24(35)25-31-19-8-9-33(3)13-22(19)37-25/h5,7,10,12,14,18,20,28H,4,6,8-9,11,13H2,1-3H3,(H,29,34)(H,30,35)/t14-,18?,20+/m0/s1 |
| InChIKey | MFXVEJMJXBUBJG-GCZMORHFSA-N |
| XLogP | 2.54 |
| TPSA | 110.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.64 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |