C27H31ClN6O3S — CID 44520920
N-[(1R,2S,5S)-2-[(6-chloroquinoline-2-carbonyl)amino]-5-(dimethylcarbamoyl)cyclohexyl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide (PubChem CID 44520920) has the molecular formula C27H31ClN6O3S and a molecular weight of 555.10 g/mol. Its IUPAC name is N-[(1R,2S,5S)-2-[(6-chloroquinoline-2-carbonyl)amino]-5-(dimethylcarbamoyl)cyclohexyl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide.
| Compound Name | N-[(1R,2S,5S)-2-[(6-chloroquinoline-2-carbonyl)amino]-5-(dimethylcarbamoyl)cyclohexyl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 44520920 |
| Molecular Formula | C27H31ClN6O3S |
| Molecular Weight | 555.10 g/mol |
| Exact Mass | 554.19 |
| IUPAC Name | N-[(1R,2S,5S)-2-[(6-chloroquinoline-2-carbonyl)amino]-5-(dimethylcarbamoyl)cyclohexyl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide |
| SMILES | CN1CCc2nc(C(=O)N[C@@H]3C[C@@H](C(=O)N(C)C)CC[C@@H]3NC(=O)c3ccc4cc(Cl)ccc4n3)sc2C1 |
| InChI | InChI=1S/C27H31ClN6O3S/c1-33(2)27(37)16-5-7-19(30-24(35)21-8-4-15-12-17(28)6-9-18(15)29-21)22(13-16)31-25(36)26-32-20-10-11-34(3)14-23(20)38-26/h4,6,8-9,12,16,19,22H,5,7,10-11,13-14H2,1-3H3,(H,30,35)(H,31,36)/t16-,19-,22+/m0/s1 |
| InChIKey | NBYHGOPTYAMMNR-XWFZLUIHSA-N |
| XLogP | 3.12 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.10 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |