C24H28O5 — CID 44520989
(E)-3-[2-[2-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)ethoxy]phenyl]prop-2-enoic acid (PubChem CID 44520989) has the molecular formula C24H28O5 and a molecular weight of 396.48 g/mol. Its IUPAC name is (E)-3-[2-[2-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)ethoxy]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-[2-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)ethoxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 44520989 |
| Molecular Formula | C24H28O5 |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | (E)-3-[2-[2-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)ethoxy]phenyl]prop-2-enoic acid |
| SMILES | Cc1c(C)c2c(c(C)c1O)CCC(C)(CCOc1ccccc1/C=C/C(=O)O)O2 |
| InChI | InChI=1S/C24H28O5/c1-15-16(2)23-19(17(3)22(15)27)11-12-24(4,29-23)13-14-28-20-8-6-5-7-18(20)9-10-21(25)26/h5-10,27H,11-14H2,1-4H3,(H,25,26)/b10-9+ |
| InChIKey | FFXXDYJVLLGASF-MDZDMXLPSA-N |
| XLogP | 4.97 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|