About 4-[(5,6-dimethyl-2-pyridin-2-yl-3-pyridinyl)oxy]-N-(4-fluorophenyl)pyridin-2-amine
4-[(5,6-dimethyl-2-pyridin-2-yl-3-pyridinyl)oxy]-N-(4-fluorophenyl)pyridin-2-amine (PubChem CID 44521026) has the molecular formula C23H19FN4O
and a molecular weight of 386.43 g/mol. Its IUPAC name is 4-[(5,6-dimethyl-2-pyridin-2-yl-3-pyridinyl)oxy]-N-(4-fluorophenyl)pyridin-2-amine.
Molecular Properties
| Compound Name | 4-[(5,6-dimethyl-2-pyridin-2-yl-3-pyridinyl)oxy]-N-(4-fluorophenyl)pyridin-2-amine |
| PubChem CID | 44521026 |
| Molecular Formula | C23H19FN4O |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 4-[(5,6-dimethyl-2-pyridin-2-yl-3-pyridinyl)oxy]-N-(4-fluorophenyl)pyridin-2-amine |
| SMILES | Cc1cc(Oc2ccnc(Nc3ccc(F)cc3)c2)c(-c2ccccn2)nc1C |
| InChI | InChI=1S/C23H19FN4O/c1-15-13-21(23(27-16(15)2)20-5-3-4-11-25-20)29-19-10-12-26-22(14-19)28-18-8-6-17(24)7-9-18/h3-14H,1-2H3,(H,26,28) |
| InChIKey | GEDJWDMJHOZAHV-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(5,6-dimethyl-2-pyridin-2-yl-3-pyridinyl)oxy]-N-(4-fluorophenyl)pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(5,6-dimethyl-2-pyridin-2-yl-3-pyridinyl)oxy]-N-(4-fluorophenyl)pyridin-2-amine?
The IUPAC name of 4-[(5,6-dimethyl-2-pyridin-2-yl-3-pyridinyl)oxy]-N-(4-fluorophenyl)pyridin-2-amine (CID 44521026) is 4-[(5,6-dimethyl-2-pyridin-2-yl-3-pyridinyl)oxy]-N-(4-fluorophenyl)pyridin-2-amine.
What is the SMILES notation for 4-[(5,6-dimethyl-2-pyridin-2-yl-3-pyridinyl)oxy]-N-(4-fluorophenyl)pyridin-2-amine?
The canonical SMILES for 4-[(5,6-dimethyl-2-pyridin-2-yl-3-pyridinyl)oxy]-N-(4-fluorophenyl)pyridin-2-amine is Cc1cc(Oc2ccnc(Nc3ccc(F)cc3)c2)c(-c2ccccn2)nc1C.
What is the InChIKey of 4-[(5,6-dimethyl-2-pyridin-2-yl-3-pyridinyl)oxy]-N-(4-fluorophenyl)pyridin-2-amine?
The InChIKey is GEDJWDMJHOZAHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19FN4O/c1-15-13-21(23(27-16(15)2)20-5-3-4-11-25-20)29-19-10-12-26-22(14-19)28-18-8-6-17(24)7-9-18/h3-14H,1-2H3,(H,26,28).
What are the key properties of 4-[(5,6-dimethyl-2-pyridin-2-yl-3-pyridinyl)oxy]-N-(4-fluorophenyl)pyridin-2-amine?
4-[(5,6-dimethyl-2-pyridin-2-yl-3-pyridinyl)oxy]-N-(4-fluorophenyl)pyridin-2-amine has a molecular weight of 386.43 g/mol, XLogP of 5.83, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(5,6-dimethyl-2-pyridin-2-yl-3-pyridinyl)oxy]-N-(4-fluorophenyl)pyridin-2-amine is sourced from PubChem (CID 44521026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).