C24H26N2O2Se2 — CID 44521232
2,5-bis(3-phenylselanylpropylamino)cyclohexa-2,5-diene-1,4-dione (PubChem CID 44521232) has the molecular formula C24H26N2O2Se2 and a molecular weight of 532.40 g/mol. Its IUPAC name is 2,5-bis(3-phenylselanylpropylamino)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,5-bis(3-phenylselanylpropylamino)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 44521232 |
| Molecular Formula | C24H26N2O2Se2 |
| Molecular Weight | 532.40 g/mol |
| Exact Mass | 534.03 |
| IUPAC Name | 2,5-bis(3-phenylselanylpropylamino)cyclohexa-2,5-diene-1,4-dione |
| SMILES | O=C1C=C(NCCC[Se]c2ccccc2)C(=O)C=C1NCCC[Se]c1ccccc1 |
| InChI | InChI=1S/C24H26N2O2Se2/c27-23-18-22(26-14-8-16-30-20-11-5-2-6-12-20)24(28)17-21(23)25-13-7-15-29-19-9-3-1-4-10-19/h1-6,9-12,17-18,25-26H,7-8,13-16H2 |
| InChIKey | HVKGOIHCBNMMOP-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.40 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|