C37H36N16 — CID 44521463
[1-[4-[tris[4-[4-(aminomethyl)triazol-1-yl]phenyl]methyl]phenyl]triazol-4-yl]methanamine (PubChem CID 44521463) has the molecular formula C37H36N16 and a molecular weight of 704.81 g/mol. Its IUPAC name is [1-[4-[tris[4-[4-(aminomethyl)triazol-1-yl]phenyl]methyl]phenyl]triazol-4-yl]methanamine.
| Compound Name | [1-[4-[tris[4-[4-(aminomethyl)triazol-1-yl]phenyl]methyl]phenyl]triazol-4-yl]methanamine |
|---|---|
| PubChem CID | 44521463 |
| Molecular Formula | C37H36N16 |
| Molecular Weight | 704.81 g/mol |
| Exact Mass | 704.33 |
| IUPAC Name | [1-[4-[tris[4-[4-(aminomethyl)triazol-1-yl]phenyl]methyl]phenyl]triazol-4-yl]methanamine |
| SMILES | NCc1cn(-c2ccc(C(c3ccc(-n4cc(CN)nn4)cc3)(c3ccc(-n4cc(CN)nn4)cc3)c3ccc(-n4cc(CN)nn4)cc3)cc2)nn1 |
| InChI | InChI=1S/C37H36N16/c38-17-29-21-50(46-42-29)33-9-1-25(2-10-33)37(26-3-11-34(12-4-26)51-22-30(18-39)43-47-51,27-5-13-35(14-6-27)52-23-31(19-40)44-48-52)28-7-15-36(16-8-28)53-24-32(20-41)45-49-53/h1-16,21-24H,17-20,38-41H2 |
| InChIKey | ICECRUVYORMJMD-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 226.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.81 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|