About (E)-N-bis(2,6-dimethylphenyl)phosphoryl-1-(furan-2-yl)methanimine
(E)-N-bis(2,6-dimethylphenyl)phosphoryl-1-(furan-2-yl)methanimine (PubChem CID 44521537) has the molecular formula C21H22NO2P
and a molecular weight of 351.39 g/mol. Its IUPAC name is (E)-N-bis(2,6-dimethylphenyl)phosphoryl-1-(furan-2-yl)methanimine.
Molecular Properties
| Compound Name | (E)-N-bis(2,6-dimethylphenyl)phosphoryl-1-(furan-2-yl)methanimine |
| PubChem CID | 44521537 |
| Molecular Formula | C21H22NO2P |
| Molecular Weight | 351.39 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | (E)-N-bis(2,6-dimethylphenyl)phosphoryl-1-(furan-2-yl)methanimine |
| SMILES | Cc1cccc(C)c1P(=O)(/N=C/c1ccco1)c1c(C)cccc1C |
| InChI | InChI=1S/C21H22NO2P/c1-15-8-5-9-16(2)20(15)25(23,22-14-19-12-7-13-24-19)21-17(3)10-6-11-18(21)4/h5-14H,1-4H3/b22-14+ |
| InChIKey | NWUDUPMWCVLXAI-HYARGMPZSA-N |
| XLogP | 4.86 |
| TPSA | 42.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.39 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-bis(2,6-dimethylphenyl)phosphoryl-1-(furan-2-yl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-bis(2,6-dimethylphenyl)phosphoryl-1-(furan-2-yl)methanimine?
The IUPAC name of (E)-N-bis(2,6-dimethylphenyl)phosphoryl-1-(furan-2-yl)methanimine (CID 44521537) is (E)-N-bis(2,6-dimethylphenyl)phosphoryl-1-(furan-2-yl)methanimine.
What is the SMILES notation for (E)-N-bis(2,6-dimethylphenyl)phosphoryl-1-(furan-2-yl)methanimine?
The canonical SMILES for (E)-N-bis(2,6-dimethylphenyl)phosphoryl-1-(furan-2-yl)methanimine is Cc1cccc(C)c1P(=O)(/N=C/c1ccco1)c1c(C)cccc1C.
What is the InChIKey of (E)-N-bis(2,6-dimethylphenyl)phosphoryl-1-(furan-2-yl)methanimine?
The InChIKey is NWUDUPMWCVLXAI-HYARGMPZSA-N. The full InChI is InChI=1S/C21H22NO2P/c1-15-8-5-9-16(2)20(15)25(23,22-14-19-12-7-13-24-19)21-17(3)10-6-11-18(21)4/h5-14H,1-4H3/b22-14+.
What are the key properties of (E)-N-bis(2,6-dimethylphenyl)phosphoryl-1-(furan-2-yl)methanimine?
(E)-N-bis(2,6-dimethylphenyl)phosphoryl-1-(furan-2-yl)methanimine has a molecular weight of 351.39 g/mol, XLogP of 4.86, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-bis(2,6-dimethylphenyl)phosphoryl-1-(furan-2-yl)methanimine is sourced from PubChem (CID 44521537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).