C25H31NO5SSi — CID 44521581
methyl (2S,3S,4E)-4-[1-[dimethyl(phenyl)silyl]ethylidene]-1-(4-methylphenyl)sulfonyl-3-(2-oxoethyl)pyrrolidine-2-carboxylate (PubChem CID 44521581) has the molecular formula C25H31NO5SSi and a molecular weight of 485.68 g/mol. Its IUPAC name is methyl (2S,3S,4E)-4-[1-[dimethyl(phenyl)silyl]ethylidene]-1-(4-methylphenyl)sulfonyl-3-(2-oxoethyl)pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,3S,4E)-4-[1-[dimethyl(phenyl)silyl]ethylidene]-1-(4-methylphenyl)sulfonyl-3-(2-oxoethyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 44521581 |
| Molecular Formula | C25H31NO5SSi |
| Molecular Weight | 485.68 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | methyl (2S,3S,4E)-4-[1-[dimethyl(phenyl)silyl]ethylidene]-1-(4-methylphenyl)sulfonyl-3-(2-oxoethyl)pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H](CC=O)/C(=C(/C)[Si](C)(C)c2ccccc2)CN1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C25H31NO5SSi/c1-18-11-13-20(14-12-18)32(29,30)26-17-23(22(15-16-27)24(26)25(28)31-3)19(2)33(4,5)21-9-7-6-8-10-21/h6-14,16,22,24H,15,17H2,1-5H3/b23-19-/t22-,24-/m0/s1 |
| InChIKey | HWMKVLZUNBUWQG-GTZAOEHJSA-N |
| XLogP | 3.22 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.68 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|