C20H19BrN2S2 — CID 44521585
(4S)-1-benzyl-4-(3-bromophenyl)-4,5,7,8-tetrahydro-3H-thiopyrano[4,3-d]pyrimidine-2-thione (PubChem CID 44521585) has the molecular formula C20H19BrN2S2 and a molecular weight of 431.42 g/mol. Its IUPAC name is (4S)-1-benzyl-4-(3-bromophenyl)-4,5,7,8-tetrahydro-3H-thiopyrano[4,3-d]pyrimidine-2-thione.
| Compound Name | (4S)-1-benzyl-4-(3-bromophenyl)-4,5,7,8-tetrahydro-3H-thiopyrano[4,3-d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 44521585 |
| Molecular Formula | C20H19BrN2S2 |
| Molecular Weight | 431.42 g/mol |
| Exact Mass | 430.02 |
| IUPAC Name | (4S)-1-benzyl-4-(3-bromophenyl)-4,5,7,8-tetrahydro-3H-thiopyrano[4,3-d]pyrimidine-2-thione |
| SMILES | S=C1N[C@@H](c2cccc(Br)c2)C2=C(CCSC2)N1Cc1ccccc1 |
| InChI | InChI=1S/C20H19BrN2S2/c21-16-8-4-7-15(11-16)19-17-13-25-10-9-18(17)23(20(24)22-19)12-14-5-2-1-3-6-14/h1-8,11,19H,9-10,12-13H2,(H,22,24)/t19-/m0/s1 |
| InChIKey | XIXLFFQYCFYKEG-IBGZPJMESA-N |
| XLogP | 5.27 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.42 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|