C23H44O6Si — CID 44521803
(2R,3R,4E)-2-[tert-butyl(dimethyl)silyl]oxy-6-[(2R,5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]-3,4-dimethylhepta-4,6-dien-1-ol (PubChem CID 44521803) has the molecular formula C23H44O6Si and a molecular weight of 444.69 g/mol. Its IUPAC name is (2R,3R,4E)-2-[tert-butyl(dimethyl)silyl]oxy-6-[(2R,5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]-3,4-dimethylhepta-4,6-dien-1-ol.
| Compound Name | (2R,3R,4E)-2-[tert-butyl(dimethyl)silyl]oxy-6-[(2R,5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]-3,4-dimethylhepta-4,6-dien-1-ol |
|---|---|
| PubChem CID | 44521803 |
| Molecular Formula | C23H44O6Si |
| Molecular Weight | 444.69 g/mol |
| Exact Mass | 444.29 |
| IUPAC Name | (2R,3R,4E)-2-[tert-butyl(dimethyl)silyl]oxy-6-[(2R,5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]-3,4-dimethylhepta-4,6-dien-1-ol |
| SMILES | C=C(/C=C(\C)[C@@H](C)[C@H](CO)O[Si](C)(C)C(C)(C)C)[C@@H]1CO[C@@](C)(OC)[C@](C)(OC)O1 |
| InChI | InChI=1S/C23H44O6Si/c1-16(18(3)19(14-24)29-30(11,12)21(4,5)6)13-17(2)20-15-27-22(7,25-9)23(8,26-10)28-20/h13,18-20,24H,2,14-15H2,1,3-12H3/b16-13+/t18-,19+,20+,22-,23-/m1/s1 |
| InChIKey | QFHHHRZWMGMGBT-VUAIPAQLSA-N |
| XLogP | 4.65 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.69 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|