C17H22NS+ — CID 44521877
3-(2,4,6-trimethylphenyl)-5,6,7,8-tetrahydro-4H-cyclohepta[d][1,3]thiazol-3-ium (PubChem CID 44521877) has the molecular formula C17H22NS+ and a molecular weight of 272.44 g/mol. Its IUPAC name is 3-(2,4,6-trimethylphenyl)-5,6,7,8-tetrahydro-4H-cyclohepta[d][1,3]thiazol-3-ium.
| Compound Name | 3-(2,4,6-trimethylphenyl)-5,6,7,8-tetrahydro-4H-cyclohepta[d][1,3]thiazol-3-ium |
|---|---|
| PubChem CID | 44521877 |
| Molecular Formula | C17H22NS+ |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 3-(2,4,6-trimethylphenyl)-5,6,7,8-tetrahydro-4H-cyclohepta[d][1,3]thiazol-3-ium |
| SMILES | Cc1cc(C)c(-[n+]2csc3c2CCCCC3)c(C)c1 |
| InChI | InChI=1S/C17H22NS/c1-12-9-13(2)17(14(3)10-12)18-11-19-16-8-6-4-5-7-15(16)18/h9-11H,4-8H2,1-3H3/q+1 |
| InChIKey | IRJLJZCXBCKFMB-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|